160282-16-6 Usage
Description
(Z)-3-[[[(2-methylphenyl)-phenyl-methylidene]amino]carbamoyl]prop-2-en oic acid is a chemical compound characterized by its molecular formula C21H20N2O3. It is a derivative of propenoic acid, featuring an amino carbamoyl group, two aromatic rings, and a double bond with the (Z) configuration. (Z)-3-[[[(2-methylphenyl)-phenyl-methylidene]amino]carbamoyl]prop-2-en oic acid may have potential applications in various industries, including pharmaceuticals and dyes, due to its unique structure and properties. Further research and testing are required to explore its full potential and understand its properties.
Uses
Used in Pharmaceutical Industry:
(Z)-3-[[[(2-methylphenyl)-phenyl-methylidene]amino]carbamoyl]prop-2-en oic acid is used as a potential pharmaceutical compound for its possible therapeutic applications. (Z)-3-[[[(2-methylphenyl)-phenyl-methylidene]amino]carbamoyl]prop-2-en oic acid's unique structure may allow it to interact with biological targets, potentially leading to the development of new drugs for various medical conditions.
Used in Dye Industry:
(Z)-3-[[[(2-methylphenyl)-phenyl-methylidene]amino]carbamoyl]prop-2-en oic acid is used as a potential dye compound due to its aromatic rings and double bond, which may contribute to its color properties. Further research is needed to determine its suitability and efficiency as a dye in various applications.
Check Digit Verification of cas no
The CAS Registry Mumber 160282-16-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,6,0,2,8 and 2 respectively; the second part has 2 digits, 1 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 160282-16:
(8*1)+(7*6)+(6*0)+(5*2)+(4*8)+(3*2)+(2*1)+(1*6)=106
106 % 10 = 6
So 160282-16-6 is a valid CAS Registry Number.
InChI:InChI=1/C18H16N2O3/c1-13-7-5-6-10-15(13)18(14-8-3-2-4-9-14)20-19-16(21)11-12-17(22)23/h2-12H,1H3,(H,19,21)(H,22,23)/b12-11-,20-18+