16325-01-2 Usage
General Description
NITRO BLUE TETRAZOLIUM FORMAZAN, often referred to as NBT, is a chemical compound commonly used in biological and biochemical assays to detect the presence of certain enzymes and metabolic activities. When NBT is reduced by enzymes like dehydrogenases, it forms an insoluble blue formazan precipitate, providing a visual indication of enzyme activity. NBT is particularly useful in detecting the presence of superoxide radicals produced by cells during oxidative stress, and it is a crucial tool in studying various cellular processes such as respiration and photosynthesis. Its ability to produce a visible color change makes NBT a valuable reagent in the field of biochemistry and molecular biology.
Check Digit Verification of cas no
The CAS Registry Mumber 16325-01-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,6,3,2 and 5 respectively; the second part has 2 digits, 0 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 16325-01:
(7*1)+(6*6)+(5*3)+(4*2)+(3*5)+(2*0)+(1*1)=82
82 % 10 = 2
So 16325-01-2 is a valid CAS Registry Number.
InChI:InChI=1/C40H32N10O6/c1-55-37-25-29(13-23-35(37)43-47-39(27-9-5-3-6-10-27)45-41-31-15-19-33(20-16-31)49(51)52)30-14-24-36(38(26-30)56-2)44-48-40(28-11-7-4-8-12-28)46-42-32-17-21-34(22-18-32)50(53)54/h3-26,41-42H,1-2H3/b45-39+,46-40+,47-43+,48-44+