163260-73-9 Usage
Description
4-(1,4-Dioxaspiro[4,5]dec-8-yl)-benzoic acid is a spiro compound with the molecular formula C15H16O4. It features a spiro[4.5]decane ring system fused to a benzoic acid moiety, providing it with unique structural and reactive properties. This chemical compound is of interest in the fields of medicinal chemistry, drug development, pharmacology, and biochemistry due to its potential applications and biological activities.
Uses
Used in Organic Synthesis:
4-(1,4-Dioxaspiro[4,5]dec-8-yl)-benzoic acid is used as a building block in organic synthesis for the creation of various biologically active molecules. Its unique spiro structure and reactivity make it a valuable component in the synthesis of complex organic compounds.
Used in Pharmaceutical Research:
In pharmaceutical research, 4-(1,4-Dioxaspiro[4,5]dec-8-yl)-benzoic acid serves as a key intermediate for the development of new drugs. Its incorporation into drug molecules can potentially lead to the discovery of novel therapeutic agents with improved efficacy and selectivity.
Used in Medicinal Chemistry:
4-(1,4-Dioxaspiro[4,5]dec-8-yl)-benzoic acid is utilized in medicinal chemistry for the design and synthesis of drug candidates. Its structural features can be exploited to enhance the pharmacokinetic and pharmacodynamic properties of potential drugs, contributing to the advancement of new therapeutic agents.
Used in Drug Development:
In the realm of drug development, 4-(1,4-Dioxaspiro[4,5]dec-8-yl)-benzoic acid is employed as a starting material for the synthesis of innovative pharmaceuticals. Its unique chemical properties can be harnessed to develop drugs with novel mechanisms of action and improved therapeutic profiles.
Used in Pharmacology and Biochemistry:
4-(1,4-Dioxaspiro[4,5]dec-8-yl)-benzoic acid is of interest for further investigation in pharmacology and biochemistry due to its potential biological activities. Research into its interactions with biological systems may reveal new insights into its therapeutic potential and mechanisms of action.
Check Digit Verification of cas no
The CAS Registry Mumber 163260-73-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,6,3,2,6 and 0 respectively; the second part has 2 digits, 7 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 163260-73:
(8*1)+(7*6)+(6*3)+(5*2)+(4*6)+(3*0)+(2*7)+(1*3)=119
119 % 10 = 9
So 163260-73-9 is a valid CAS Registry Number.
InChI:InChI=1/C15H18O4/c16-14(17)13-3-1-11(2-4-13)12-5-7-15(8-6-12)18-9-10-19-15/h1-4,12H,5-10H2,(H,16,17)
