163733-98-0 Usage
General Description
Phenol, 2-amino-3,5-difluoro- (9CI) is a chemical compound with the molecular formula C6H4F2N. It is a derivative of phenol, with two fluorine atoms and an amino group attached to the benzene ring. Phenol, 2-amino-3,5-difluoro- (9CI) is used in the production of various pharmaceuticals, agrochemicals, and dyes. Its unique structure and fluorine atoms make it a valuable building block in the synthesis of new chemical compounds with potential applications in drug discovery and development. Additionally, this chemical is also of interest in the field of medicinal chemistry for its potential biological activities and pharmacological properties. Due to its potential applications and properties, Phenol, 2-amino-3,5-difluoro- (9CI) is an important chemical compound in the fields of chemistry and pharmaceuticals.
Check Digit Verification of cas no
The CAS Registry Mumber 163733-98-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,6,3,7,3 and 3 respectively; the second part has 2 digits, 9 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 163733-98:
(8*1)+(7*6)+(6*3)+(5*7)+(4*3)+(3*3)+(2*9)+(1*8)=150
150 % 10 = 0
So 163733-98-0 is a valid CAS Registry Number.
InChI:InChI=1/C6H5F2NO/c7-3-1-4(8)6(9)5(10)2-3/h1-2,10H,9H2
