16378-06-6 Usage
General Description
3-Thien-3-ylpropanoic acid is a chemical compound with the molecular formula C8H8O2S. It is a derivative of thienylpropanoic acid, with a thienyl group attached to the third position of the carbon chain. 3-THIEN-3-YLPROPANOIC ACID is a carboxylic acid and is therefore acidic in nature. It is used in organic synthesis and pharmaceutical research, and has potential applications in the development of new drugs and pharmaceuticals. Its molecular structure and properties make it a valuable building block for the synthesis of various bioactive compounds. Additionally, its unique structure may contribute to its potential biological activity and pharmacological properties, making it a subject of interest in medicinal chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 16378-06-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,6,3,7 and 8 respectively; the second part has 2 digits, 0 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 16378-06:
(7*1)+(6*6)+(5*3)+(4*7)+(3*8)+(2*0)+(1*6)=116
116 % 10 = 6
So 16378-06-6 is a valid CAS Registry Number.
InChI:InChI=1/C7H8O2S/c8-7(9)2-1-6-3-4-10-5-6/h3-5H,1-2H2,(H,8,9)/p-1