166943-39-1 Usage
Description
N-Methyl-4-nitrophenethylamine hydrochloride is an organic compound that serves as a key intermediate in the synthesis of various pharmaceuticals and chemical compounds. It is characterized by its amine and hydrochloride functional groups, which contribute to its reactivity and solubility properties.
Uses
Used in Pharmaceutical Industry:
N-Methyl-4-nitrophenethylamine hydrochloride is used as a reactant for the preparation of small molecule CDC25 phosphatase inhibitors. These inhibitors are important in the development of drugs targeting the regulation of protein phosphorylation, which plays a crucial role in various cellular processes, including cell cycle progression and signal transduction. By inhibiting CDC25 phosphatases, these small molecules can potentially be used to treat a range of diseases, including cancer, by disrupting the normal cell cycle and preventing uncontrolled cell growth.
Check Digit Verification of cas no
The CAS Registry Mumber 166943-39-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,6,6,9,4 and 3 respectively; the second part has 2 digits, 3 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 166943-39:
(8*1)+(7*6)+(6*6)+(5*9)+(4*4)+(3*3)+(2*3)+(1*9)=171
171 % 10 = 1
So 166943-39-1 is a valid CAS Registry Number.
InChI:InChI=1/C9H12N2O2.ClH/c1-10-7-6-8-2-4-9(5-3-8)11(12)13;/h2-5,10H,6-7H2,1H3;1H