169530-97-6 Usage
Description
D-3-NITROPHENYLALANINE is an amino acid derivative that possesses a nitro group attached to the phenylalanine molecule. It is a unique compound with potential applications in various fields due to its distinct chemical properties.
Uses
Used in Pharmaceutical Industry:
D-3-NITROPHENYLALANINE is used as a reagent for the synthesis of new cyclic plasmin inhibitors with excellent potency and selectivity. These inhibitors can be crucial in the development of novel therapeutic agents for various medical conditions, particularly those involving clotting or fibrinolysis.
Check Digit Verification of cas no
The CAS Registry Mumber 169530-97-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,6,9,5,3 and 0 respectively; the second part has 2 digits, 9 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 169530-97:
(8*1)+(7*6)+(6*9)+(5*5)+(4*3)+(3*0)+(2*9)+(1*7)=166
166 % 10 = 6
So 169530-97-6 is a valid CAS Registry Number.
InChI:InChI=1/C9H10N2O4/c10-8(9(12)13)5-6-2-1-3-7(4-6)11(14)15/h1-4,8H,5,10H2,(H,12,13)/t8-/m1/s1