172800-05-4 Usage
Description
[(1R,2R)-2-(dimethylaminomethyl)cyclohexyl] N-(2-octoxyphenyl)carbamate hydrochloride is a complex organic compound featuring a cyclohexyl ring with a dimethylaminomethyl group and an octoxyphenyl group attached. It also contains a carbamate functional group and is presented as a hydrochloride salt. This chemical is characterized by its unique molecular structure, which may endow it with specific biological activities, making it a candidate for pharmaceutical development and research applications.
Uses
Used in Pharmaceutical Industry:
[(1R,2R)-2-(dimethylaminomethyl)cyclohexyl] N-(2-octoxyphenyl)carbamate hydrochloride is used as a potential pharmaceutical ingredient due to its unique structure and possible biological activity. Its specific application within the pharmaceutical industry may involve targeting various diseases or conditions based on its interactions with biological systems.
Used in Research Applications:
In the field of research, [(1R,2R)-2-(dimethylaminomethyl)cyclohexyl] N-(2-octoxyphenyl)carbamate hydrochloride serves as a valuable compound for studying its chemical properties, potential interactions with biological molecules, and its overall behavior in various experimental setups. This can contribute to the advancement of scientific knowledge and the development of new therapeutic strategies.
It is crucial to handle and utilize this chemical with care, adhering to safety guidelines and regulations to ensure the safety of both researchers and the environment.
Check Digit Verification of cas no
The CAS Registry Mumber 172800-05-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,2,8,0 and 0 respectively; the second part has 2 digits, 0 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 172800-05:
(8*1)+(7*7)+(6*2)+(5*8)+(4*0)+(3*0)+(2*0)+(1*5)=114
114 % 10 = 4
So 172800-05-4 is a valid CAS Registry Number.
InChI:InChI=1/C24H40N2O3.ClH/c1-4-5-6-7-8-13-18-28-23-17-12-10-15-21(23)25-24(27)29-22-16-11-9-14-20(22)19-26(2)3;/h10,12,15,17,20,22H,4-9,11,13-14,16,18-19H2,1-3H3,(H,25,27);1H/t20-,22-;/m1./s1