17315-76-3 Usage
Description
2-Hydroxyglutaconianil hydrochloride is a chemical compound derived from glutaric acid, known for its ability to form complexes with metal ions and its unique chemical structure and properties.
Uses
Used in Laboratory Research:
2-Hydroxyglutaconianil hydrochloride is used as a reagent for the detection and quantification of amino acids, aiding in various scientific studies and analyses.
Used in Pharmaceutical Synthesis:
In the pharmaceutical industry, 2-Hydroxyglutaconianil hydrochloride is utilized in the synthesis of compounds with anti-inflammatory and analgesic properties, contributing to the development of potential treatments for pain and inflammation.
Used in Analytical Techniques:
Due to its metal ion complexation capabilities, 2-Hydroxyglutaconianil hydrochloride is employed in certain analytical techniques, enhancing the efficiency and accuracy of these methods.
Used in Material and Polymer Development:
2-Hydroxyglutaconianil hydrochloride has potential applications in the development of new materials and polymers, owing to its distinctive chemical structure and properties, which can be harnessed to create innovative products and technologies.
Check Digit Verification of cas no
The CAS Registry Mumber 17315-76-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,7,3,1 and 5 respectively; the second part has 2 digits, 7 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 17315-76:
(7*1)+(6*7)+(5*3)+(4*1)+(3*5)+(2*7)+(1*6)=103
103 % 10 = 3
So 17315-76-3 is a valid CAS Registry Number.
InChI:InChI=1/C17H16N2O/c20-17(14-19-16-10-5-2-6-11-16)12-7-13-18-15-8-3-1-4-9-15/h1-14,18,20H/b13-7+,17-12-,19-14+