17332-39-7 Usage
Description
1-(3,4-Diethoxybenzyl)-6,7-diethoxyisoquinolinium sulphamate is a chemical compound that belongs to the class of isoquinolinium salts. It features both sulphamate and diethoxybenzyl functional groups, which contribute to its potential applications in the field of pharmacology. 1-(3,4-Diethoxybenzyl)-6,7-diethoxyisoquinolinium sulphamate has been studied for its potential biological activities, such as anticonvulsant and antiarrhythmic properties. Its unique chemical structure makes it a promising candidate for further research in the development of new pharmaceuticals. However, its exact mechanisms of action and potential side effects are still under investigation. Overall, 1-(3,4-Diethoxybenzyl)-6,7-diethoxyisoquinolinium sulphamate shows promise as a versatile compound with potential therapeutic applications.
Uses
Used in Pharmaceutical Industry:
1-(3,4-Diethoxybenzyl)-6,7-diethoxyisoquinolinium sulphamate is used as a research compound for its potential anticonvulsant and antiarrhythmic properties. Its unique chemical structure allows for further investigation into its mechanisms of action and potential side effects, with the aim of developing new pharmaceuticals for the treatment of various conditions.
Used in Research and Development:
In the field of research and development, 1-(3,4-Diethoxybenzyl)-6,7-diethoxyisoquinolinium sulphamate serves as a valuable compound for exploring its potential therapeutic applications. Its study can lead to a better understanding of its biological activities and contribute to the advancement of pharmaceutical science.
Check Digit Verification of cas no
The CAS Registry Mumber 17332-39-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,7,3,3 and 2 respectively; the second part has 2 digits, 3 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 17332-39:
(7*1)+(6*7)+(5*3)+(4*3)+(3*2)+(2*3)+(1*9)=97
97 % 10 = 7
So 17332-39-7 is a valid CAS Registry Number.
InChI:InChI=1/C24H29NO4.H3NO3S/c1-5-26-21-10-9-17(14-22(21)27-6-2)13-20-19-16-24(29-8-4)23(28-7-3)15-18(19)11-12-25-20;1-5(2,3)4/h9-12,14-16H,5-8,13H2,1-4H3;(H3,1,2,3,4)