1736-85-2 Usage
Description
2-Fluoro-1,3-diMethyl-5-nitrobenzene is an organic compound characterized by the presence of a fluorine atom at the 2nd position, two methyl groups at the 1st and 3rd positions, and a nitro group at the 5th position on a benzene ring. This chemical structure endows it with unique properties that make it a valuable intermediate in the synthesis of various pharmaceutical compounds.
Uses
Used in Pharmaceutical Industry:
2-Fluoro-1,3-diMethyl-5-nitrobenzene is used as a key intermediate in the synthesis of (benzoylaminophenoxy)phenol derivatives, which are known as androgen receptor antagonists. These antagonists play a crucial role in the development of medications targeting hormonal imbalances and conditions related to androgen receptors, such as prostate cancer and other androgen-dependent disorders.
Check Digit Verification of cas no
The CAS Registry Mumber 1736-85-2 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,7,3 and 6 respectively; the second part has 2 digits, 8 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 1736-85:
(6*1)+(5*7)+(4*3)+(3*6)+(2*8)+(1*5)=92
92 % 10 = 2
So 1736-85-2 is a valid CAS Registry Number.
InChI:InChI=1S/C8H8FNO2/c1-5-3-7(10(11)12)4-6(2)8(5)9/h3-4H,1-2H3
1736-85-2Relevant articles and documents
New 4,4'-Bis(9-carbazolyl)-biphenyl derivatives with locked carbazole-biphenyl junctions: High-triplet state energy materials
Gantenbein, Markus,Hellstern, Manuel,Le Pleux, Lo?c,Neuburger, Markus,Mayor, Marcel
, p. 1772 - 1779 (2015/03/18)
We synthesized a series of 4,4'-bis(9-carbazolyl)-biphenyl (CBP) derivatives, using methyl groups as spatially demanding groups, locking the angle between the carbazole subunit and the biphenyl backbone as potential matrix material for blue organic light-
