175135-83-8 Usage
Molecular weight
240.31 g/mol (the mass of one mole of the compound)
Thionamide derivative
(a compound derived from nicotinamide by replacing the amide group with a thioether group)
Nicotinamide ring
(a six-membered ring structure that is part of the compound's chemical structure)
Thioether group
(a group consisting of a sulfur atom and two alkyl or aryl groups within the compound's chemical structure)
Methylphenyl group
(a group consisting of a methyl group (CH3) attached to a phenyl ring (a six-membered ring with six hydrogen atoms) within the compound's chemical structure)
Anticancer agent
(a potential substance used in the prevention or treatment of cancer)
Therapeutic properties
(the potential for the compound to have medicinal benefits and treat certain conditions)
Potent anticancer activity
(strong evidence suggesting that the compound has a significant ability to inhibit or prevent cancer growth)
Novel drug candidate
(a new substance that is being studied for its potential use as a drug in cancer therapy)
Check Digit Verification of cas no
The CAS Registry Mumber 175135-83-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,5,1,3 and 5 respectively; the second part has 2 digits, 8 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 175135-83:
(8*1)+(7*7)+(6*5)+(5*1)+(4*3)+(3*5)+(2*8)+(1*3)=138
138 % 10 = 8
So 175135-83-8 is a valid CAS Registry Number.
InChI:InChI=1/C13H12N2OS/c1-9-4-6-10(7-5-9)17-13-11(12(14)16)3-2-8-15-13/h2-8H,1H3,(H2,14,16)
