175136-37-5 Usage
Description
(8-BROMO-3,4-DIHYDRO-2H-1,5-BENZODIOXEPIN-7-YL)(4-BROMOPHENYL)METHANONE, also known as BDPM, is a chemical compound belonging to the benzodioxepin derivatives family. It is a yellow solid with a unique molecular structure featuring a benzodioxepin ring with bromine and phenyl substituents, which imparts distinct chemical properties and reactivity. BDPM is commonly used in research laboratories for the synthesis of pharmaceuticals and agrochemicals and as a reagent in organic chemistry reactions, particularly in forming carbon-carbon and carbon-heteroatom bonds. It has also shown potential biological activity and is being investigated as a lead compound for the development of new therapeutic agents.
Uses
Used in Pharmaceutical Synthesis:
BDPM is used as a building block in the synthesis of various pharmaceuticals due to its unique molecular structure and reactivity. It aids in the creation of new drugs with potential therapeutic applications.
Used in Agrochemical Synthesis:
BDPM is also utilized as a building block in the synthesis of agrochemicals, contributing to the development of new compounds for agricultural use.
Used in Organic Chemistry Reactions:
BDPM serves as a reagent in organic chemistry, particularly in the formation of carbon-carbon and carbon-heteroatom bonds, which are essential for creating complex molecular structures.
Used in Research Laboratories:
BDPM is commonly used in research settings to study its chemical properties, reactivity, and potential applications in various fields, including pharmaceuticals and agrochemicals.
Used in the Development of New Therapeutic Agents:
Due to its demonstrated potential biological activity, BDPM is being investigated as a lead compound in the development of new therapeutic agents, which could lead to the creation of innovative treatments for various diseases and conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 175136-37-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,5,1,3 and 6 respectively; the second part has 2 digits, 3 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 175136-37:
(8*1)+(7*7)+(6*5)+(5*1)+(4*3)+(3*6)+(2*3)+(1*7)=135
135 % 10 = 5
So 175136-37-5 is a valid CAS Registry Number.
InChI:InChI=1/C16H12Br2O3/c17-11-4-2-10(3-5-11)16(19)12-8-14-15(9-13(12)18)21-7-1-6-20-14/h2-5,8-9H,1,6-7H2
