175137-45-8 Usage
Description
3-Cyclopropyl-1-phenyl-1H-pyrazol-5-amine is an organic compound with a unique molecular structure that features a cyclopropyl group, a phenyl ring, and a pyrazol-5-amine moiety. 3-CYCLOPROPYL-1-PHENYL-1H-PYRAZOL-5-AMINE is known for its potential applications in the pharmaceutical and chemical industries due to its versatile chemical properties and reactivity.
Uses
Used in Pharmaceutical Industry:
3-Cyclopropyl-1-phenyl-1H-pyrazol-5-amine is used as a reagent for the synthesis of pyrazole chalcones and heterocyclic diamides, which are considered potential anticancer agents. These synthesized compounds have shown promising results in targeting and inhibiting the growth of cancer cells, making them valuable candidates for further research and development in cancer treatment.
Used in Chemical Synthesis:
In the field of chemical synthesis, 3-Cyclopropyl-1-phenyl-1H-pyrazol-5-amine serves as a key intermediate for the creation of various complex organic molecules. Its unique structure allows for a wide range of reactions, making it a valuable building block for the development of new compounds with diverse applications in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 175137-45-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,5,1,3 and 7 respectively; the second part has 2 digits, 4 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 175137-45:
(8*1)+(7*7)+(6*5)+(5*1)+(4*3)+(3*7)+(2*4)+(1*5)=138
138 % 10 = 8
So 175137-45-8 is a valid CAS Registry Number.
InChI:InChI=1/C12H13N3/c13-12-8-11(9-6-7-9)14-15(12)10-4-2-1-3-5-10/h1-5,8-9H,6-7,13H2