17514-61-3 Usage
General Description
5-nitro-3-methyl-1-benzothiophene-2-carboxylic acid is a chemical compound with the molecular formula C10H7NO4S. It is a yellow crystalline solid that is commonly used in pharmaceutical research and development. 5-nitro-3-methyl-1-benzothiophene-2-carboxylic acid has potential applications in the synthesis of various pharmaceuticals and agrochemicals due to its ability to act as a building block for the construction of complex molecules. It is also known for its antimicrobial and anti-inflammatory properties, making it a valuable ingredient for the development of new drugs. Additionally, 5-nitro-3-methyl-1-benzothiophene-2-carboxylic acid has been studied for its potential use as a fluorescent probe in analytical chemistry and bioimaging applications.
Check Digit Verification of cas no
The CAS Registry Mumber 17514-61-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,7,5,1 and 4 respectively; the second part has 2 digits, 6 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 17514-61:
(7*1)+(6*7)+(5*5)+(4*1)+(3*4)+(2*6)+(1*1)=103
103 % 10 = 3
So 17514-61-3 is a valid CAS Registry Number.
InChI:InChI=1/C10H7NO4S/c1-5-7-4-6(11(14)15)2-3-8(7)16-9(5)10(12)13/h2-4H,1H3,(H,12,13)
17514-61-3Relevant articles and documents
Design, synthesis, and biological evaluation of novel benzo[b]thiophene-diaryl urea derivatives as potential anticancer agents
Zarei, Omid,Azimian, Fereshteh,Hamzeh-Mivehroud, Maryam,Shahbazi Mojarrad, Javid,Hemmati, Salar,Dastmalchi, Siavoush
, p. 1438 - 1448 (2020/05/28)
A hybrid pharmacophore approach was applied to design and synthesize a series of benzo[b]thiophene-diaryl urea derivatives 17a–g with potential anticancer effect. In vitro antiproliferative activities of all target compounds were evaluated against HT-29 a
