175202-63-8 Usage
General Description
3-Methyl-5-(methylthio)-4-vinylthiophene-2-carboxylic acid is a chemical compound with the molecular formula C12H12O2S2. It is an organic compound that contains a thiophene ring with methyl and carboxylic acid functional groups attached. 3-METHYL-5-(METHYLTHIO)-4-VINYLTHIOPHENE-2-CARBOXYLIC ACID is commonly used in the synthesis of pharmaceuticals and agrochemicals due to its unique structure and reactivity. It is also used in the production of organic electronic materials and dyes, making it a versatile and valuable chemical in various industries. The presence of the carboxylic acid group makes it acidic in nature and it can serve as a precursor in the synthesis of various organic compounds.
Check Digit Verification of cas no
The CAS Registry Mumber 175202-63-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,5,2,0 and 2 respectively; the second part has 2 digits, 6 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 175202-63:
(8*1)+(7*7)+(6*5)+(5*2)+(4*0)+(3*2)+(2*6)+(1*3)=118
118 % 10 = 8
So 175202-63-8 is a valid CAS Registry Number.
InChI:InChI=1/C9H10O2S2/c1-4-6-5(2)7(8(10)11)13-9(6)12-3/h4H,1H2,2-3H3,(H,10,11)
