175203-47-1 Usage
Description
3-Benzyl-1-isopropyl-2,4-dioxo-1,2,3,4-tetrahydropyrimidine-5-carbonitrile is a complex chemical compound characterized by a benzyl group, an isopropyl group, and a tetrahydropyrimidine ring with two carbonyl groups and a carbonitrile functional group. 3-BENZYL-1-ISOPROPYL-2,4-DIOXO-1,2,3,4-TETRAHYDROPYRIMIDINE-5-CARBONITRILE holds potential in the pharmaceutical industry due to its possible biological activity and its potential use in the development of new drugs.
Uses
Used in Pharmaceutical Industry:
3-Benzyl-1-isopropyl-2,4-dioxo-1,2,3,4-tetrahydropyrimidine-5-carbonitrile is used as a compound with potential biological activity for the development of new drugs. Its unique molecular structure may contribute to the creation of innovative therapeutic agents, although further research and testing are required to fully understand its properties and potential applications.
Check Digit Verification of cas no
The CAS Registry Mumber 175203-47-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,5,2,0 and 3 respectively; the second part has 2 digits, 4 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 175203-47:
(8*1)+(7*7)+(6*5)+(5*2)+(4*0)+(3*3)+(2*4)+(1*7)=121
121 % 10 = 1
So 175203-47-1 is a valid CAS Registry Number.
InChI:InChI=1/C15H15N3O2/c1-11(2)17-10-13(8-16)14(19)18(15(17)20)9-12-6-4-3-5-7-12/h3-7,10-11H,9H2,1-2H3