175205-04-6 Usage
General Description
1-(3,5-Dichlorophenyl)biguanide hydrochloride is a chemical compound that belongs to the biguanide class of chemicals. It is commonly used as an antiseptic and disinfectant due to its strong antimicrobial properties. When applied to skin, it can effectively kill bacteria, viruses, and fungi, making it a popular ingredient in topical antiseptic solutions. It is also used in various healthcare and personal care products such as mouthwashes, wound cleansers, and hand sanitizers. Additionally, this compound has been studied for its potential use in controlling blood sugar levels in diabetes patients. Although generally considered safe and effective when used as directed, it may cause skin irritation or allergic reactions in some individuals.
Check Digit Verification of cas no
The CAS Registry Mumber 175205-04-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,5,2,0 and 5 respectively; the second part has 2 digits, 0 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 175205-04:
(8*1)+(7*7)+(6*5)+(5*2)+(4*0)+(3*5)+(2*0)+(1*4)=116
116 % 10 = 6
So 175205-04-6 is a valid CAS Registry Number.
InChI:InChI=1/C8H9Cl2N5.ClH/c9-4-1-5(10)3-6(2-4)14-8(13)15-7(11)12;/h1-3H,(H6,11,12,13,14,15);1H