175205-46-6 Usage
Description
(4-[1,2,3]THIADIAZOL-4-YL-PHENYL)-ACETONITRILE, with the molecular formula C11H7N3S, is a chemical compound that features a thiadiazole ring, a phenyl group, and an acetonitrile functional group. (4-[1,2,3]THIADIAZOL-4-YL-PHENYL)-ACETONITRILE holds promise for applications in organic synthesis and pharmaceuticals due to its unique structural composition.
Uses
Used in Organic Synthesis:
(4-[1,2,3]THIADIAZOL-4-YL-PHENYL)-ACETONITRILE is used as a building block for the synthesis of various organic compounds with potential biological activities. Its unique structure allows for the creation of a wide range of molecules with different properties and applications.
Used in Pharmaceutical Industry:
(4-[1,2,3]THIADIAZOL-4-YL-PHENYL)-ACETONITRILE is used as a key intermediate in the development of new drugs. Its incorporation into drug molecules can potentially enhance their efficacy, selectivity, and other pharmacological properties, making it a valuable asset in the design and synthesis of novel therapeutic agents.
Check Digit Verification of cas no
The CAS Registry Mumber 175205-46-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,5,2,0 and 5 respectively; the second part has 2 digits, 4 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 175205-46:
(8*1)+(7*7)+(6*5)+(5*2)+(4*0)+(3*5)+(2*4)+(1*6)=126
126 % 10 = 6
So 175205-46-6 is a valid CAS Registry Number.
InChI:InChI=1/C10H7N3S/c11-6-5-8-1-3-9(4-2-8)10-7-14-13-12-10/h1-4,7H,5H2
