175277-07-3 Usage
Description
5-(3,5-Dichlorophenoxy)furan-2-carbonyl chloride is a chemical compound with the molecular formula C10H3Cl3O3. It is a derivative of furan and is commonly used in organic synthesis as a reagent for the introduction of the furan-2-carbonyl chloride group in various chemical reactions. 5-(3,5-DICHLOROPHENOXY)FURAN-2-CARBONYL CHLORIDE is a reactive intermediate that can undergo substitution reactions with various nucleophiles to form a wide range of furan-2-carbonyl chloride derivatives. It is also used as a building block in the synthesis of pharmaceuticals and agrochemicals. Due to its reactivity and potential as a building block in the production of valuable compounds, 5-(3,5-Dichlorophenoxy)furan-2-carbonyl chloride is an important chemical in the field of organic chemistry.
Uses
Used in Organic Synthesis:
5-(3,5-Dichlorophenoxy)furan-2-carbonyl chloride is used as a reagent for the introduction of the furan-2-carbonyl chloride group in various chemical reactions. Its reactivity allows it to undergo substitution reactions with various nucleophiles, leading to the formation of a wide range of furan-2-carbonyl chloride derivatives.
Used in Pharmaceutical Synthesis:
In the pharmaceutical industry, 5-(3,5-Dichlorophenoxy)furan-2-carbonyl chloride is used as a building block in the synthesis of various pharmaceutical compounds. Its unique structure and reactivity make it a valuable component in the development of new drugs.
Used in Agrochemical Synthesis:
Similarly, in the agrochemical industry, 5-(3,5-Dichlorophenoxy)furan-2-carbonyl chloride is utilized as a building block for the synthesis of agrochemicals. Its potential in forming a variety of furan-2-carbonyl chloride derivatives contributes to the creation of effective compounds for agricultural applications.
Check Digit Verification of cas no
The CAS Registry Mumber 175277-07-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,5,2,7 and 7 respectively; the second part has 2 digits, 0 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 175277-07:
(8*1)+(7*7)+(6*5)+(5*2)+(4*7)+(3*7)+(2*0)+(1*7)=153
153 % 10 = 3
So 175277-07-3 is a valid CAS Registry Number.
InChI:InChI=1/C11H5Cl3O3/c12-6-3-7(13)5-8(4-6)16-10-2-1-9(17-10)11(14)15/h1-5H
