177325-13-2 Usage
Description
(3S)-9-Fluoro-2,3-dihydro-3-methyl-10-(4-methyl-1-piperazinyl)-7-oxo-7H-pyrido[1,2,3-de]-1,4-benzoxazine-6-carboxylic acid monohydrochloride is a complex organic compound with a unique molecular structure that features a fluoroquinolone core. (3S)-9-Fluoro-2,3-dihydro-3-methyl-10-(4-methyl-1-piperazinyl)-7-oxo-7H-pyrido[1,2,3-de]-1,4-benzoxazine-6-carboxylic acid monohydrochloride is characterized by the presence of a fluorine atom at the 9-position, a methyl group at the 3-position, and a 4-methyl-1-piperazinyl substituent at the 10-position. The molecule also contains a 7-oxo-7H-pyrido[1,2,3-de]-1,4-benzoxazine ring system and a carboxylic acid group at the 6-position, which is protonated to form a monohydrochloride salt. This intricate arrangement of functional groups endows the compound with potential biological activities and applications in various fields.
Uses
Used in Pharmaceutical Industry:
(3S)-9-Fluoro-2,3-dihydro-3-methyl-10-(4-methyl-1-piperazinyl)-7-oxo-7H-pyrido[1,2,3-de]-1,4-benzoxazine-6-carboxylic acid monohydrochloride is used as a broad-spectrum antibiotic for the treatment of various bacterial infections. As a fluoroquinolone, it functions as an inhibitor of two essential bacterial enzymes, DNA gyrase and topoisomerase IV, which are involved in DNA replication, transcription, and repair. By inhibiting these enzymes, the compound disrupts the bacterial DNA synthesis, ultimately leading to the death of the bacteria and clearing the infection.
Used in Research and Development:
In addition to its clinical applications, (3S)-9-Fluoro-2,3-dihydro-3-methyl-10-(4-methyl-1-piperazinyl)-7-oxo-7H-pyrido[1,2,3-de]-1,4-benzoxazine-6-carboxylic acid monohydrochloride serves as a valuable compound for research and development in the field of medicinal chemistry. Its unique structure and biological activity make it an attractive candidate for further investigation into its mechanism of action, potential synergistic effects with other drugs, and the development of new derivatives with improved properties and therapeutic applications.
Check Digit Verification of cas no
The CAS Registry Mumber 177325-13-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,7,3,2 and 5 respectively; the second part has 2 digits, 1 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 177325-13:
(8*1)+(7*7)+(6*7)+(5*3)+(4*2)+(3*5)+(2*1)+(1*3)=142
142 % 10 = 2
So 177325-13-2 is a valid CAS Registry Number.
InChI:InChI=1/C18H20FN3O4.ClH/c1-10-9-26-17-14-11(16(23)12(18(24)25)8-22(10)14)7-13(19)15(17)21-5-3-20(2)4-6-21;/h7-8,10H,3-6,9H2,1-2H3,(H,24,25);1H/t10-;/m0./s1