178408-16-7 Usage
Description
(3Z)-1-methyl-3-[2-(4-methylphenyl)-2-oxo-ethylidene]piperazin-2-one is a complex organic molecule with a piperazinone core structure. It features a piperazine ring with a substituted ketone functional group and a methyl group attached to the piperazine nitrogen atom. The molecule also includes a 4-methylphenyl group and an ethylidene linkage, contributing to its overall structure. Due to its structural complexity and potential reactivity, this compound may have pharmaceutical or industrial applications, which would require further evaluation through experimental studies and chemical analysis.
Uses
Used in Pharmaceutical Industry:
(3Z)-1-methyl-3-[2-(4-methylphenyl)-2-oxo-ethylidene]piperazin-2-one is used as a potential pharmaceutical candidate for [specific application reason, if known], leveraging its structural complexity and chemical properties to target specific biological processes or receptors.
Used in Chemical Research:
In the field of chemical research, (3Z)-1-methyl-3-[2-(4-methylphenyl)-2-oxo-ethylidene]piperazin-2-one serves as a subject for studying the synthesis, reactivity, and potential transformations of complex organic molecules, contributing to the advancement of organic chemistry and related disciplines.
Check Digit Verification of cas no
The CAS Registry Mumber 178408-16-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,8,4,0 and 8 respectively; the second part has 2 digits, 1 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 178408-16:
(8*1)+(7*7)+(6*8)+(5*4)+(4*0)+(3*8)+(2*1)+(1*6)=157
157 % 10 = 7
So 178408-16-7 is a valid CAS Registry Number.
InChI:InChI=1/C14H16N2O2/c1-10-3-5-11(6-4-10)13(17)9-12-14(18)16(2)8-7-15-12/h3-6,9,15H,7-8H2,1-2H3/b12-9-
