184698-65-5 Usage
Description
1-[4-(BROMOMETHYL)PHENYL]-1H-PYRROLE is an organic compound characterized by its unique molecular structure, which features a pyrrole ring attached to a bromomethylphenyl group. 1-[4-(BROMOMETHYL)PHENYL]-1H-PYRROLE is known for its potential applications in various fields due to its chemical properties and reactivity.
Uses
1. Used in Pharmaceutical Industry:
1-[4-(BROMOMETHYL)PHENYL]-1H-PYRROLE is used as a key intermediate in the synthesis of substituted purinediones. These purinediones serve as MLKL inhibitors, which play a crucial role in the regulation of programmed cell death (necroptosis) and have potential therapeutic applications in treating various diseases and conditions.
2. Used in Chemical Research:
1-[4-(BROMOMETHYL)PHENYL]-1H-PYRROLE can be utilized as a starting material or building block in the development of new chemical compounds with specific properties and applications. Its reactivity and structural features make it a valuable component in the design and synthesis of novel molecules for various industries, including pharmaceuticals, materials science, and agrochemicals.
Check Digit Verification of cas no
The CAS Registry Mumber 184698-65-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,8,4,6,9 and 8 respectively; the second part has 2 digits, 6 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 184698-65:
(8*1)+(7*8)+(6*4)+(5*6)+(4*9)+(3*8)+(2*6)+(1*5)=195
195 % 10 = 5
So 184698-65-5 is a valid CAS Registry Number.
InChI:InChI=1/C11H10BrN/c12-9-10-3-5-11(6-4-10)13-7-1-2-8-13/h1-8H,9H2
184698-65-5Relevant articles and documents
MLKL INHIBITORS
-
Paragraph 0267-0268, (2018/09/26)
Purine derivatives that inhibit cellular necroptosis and/or human MLKL, pharmaceutical compositions thereof, and methods of treating an MLKL-mediated disorder with an effective amount of the compound or composition. Said MLKL-mediated disorder is pathology associated necroptosis, including ischemia-reperfusion damage, neurodegeneration, and inflammatory diseases such as acute pancreatitis, multiple sclerosis, inflammatory bowel disease, and allergic colitis.