188717-04-6 Usage
Description
ALLYL D-GLUCURONATE, also known as D-Glucuronic acid 2-propen-1-yl ester, is a white to off-white solid with unique chemical properties. It is a derivative of D-glucuronic acid, which is a key component in the synthesis of various biologically active compounds.
Uses
Used in Pharmaceutical Industry:
ALLYL D-GLUCURONATE is used as an intermediate in the efficient synthesis of 1β-O-acyl glucuronides. This application is significant due to its role in the regioselective acylation of allyl or benzyl D-glucuronate, which is crucial for the development of new drugs and therapeutic agents.
Used in Chemical Synthesis:
ALLYL D-GLUCURONATE is used as a key building block in the synthesis of various complex organic molecules. Its unique chemical properties make it a valuable component in the creation of novel compounds with potential applications in different industries, including pharmaceuticals, materials science, and agrochemicals.
Check Digit Verification of cas no
The CAS Registry Mumber 188717-04-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,8,8,7,1 and 7 respectively; the second part has 2 digits, 0 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 188717-04:
(8*1)+(7*8)+(6*8)+(5*7)+(4*1)+(3*7)+(2*0)+(1*4)=176
176 % 10 = 6
So 188717-04-6 is a valid CAS Registry Number.
InChI:InChI=1/C9H14O7/c1-2-3-15-9(14)7-5(11)4(10)6(12)8(13)16-7/h2,4-8,10-13H,1,3H2/t4-,5-,6?,7?,8?/m0/s1