190-26-1 Usage
Description
Ovalene is a large and complex hydrocarbon molecule composed of 260 carbon atoms arranged in a tubular structure. It is known for its remarkable stability and unique electronic properties, making it a promising candidate for various applications in different industries.
Uses
Used in Polymeric Nanotube Dispersants:
Ovalene is used as a dispersant for polymeric nanotubes, enhancing their dispersion in various applications. Its large size and unique structure allow it to effectively separate and stabilize nanotubes, improving their performance in different materials.
Used in Dispersant-Free Nanotube Films:
Ovalene is also used in the production of dispersant-free nanotube films. Its ability to self-assemble and form stable structures makes it an ideal candidate for creating high-quality films with enhanced properties, such as improved electrical conductivity and mechanical strength.
Check Digit Verification of cas no
The CAS Registry Mumber 190-26-1 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 1,9 and 0 respectively; the second part has 2 digits, 2 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 190-26:
(5*1)+(4*9)+(3*0)+(2*2)+(1*6)=51
51 % 10 = 1
So 190-26-1 is a valid CAS Registry Number.
InChI:InChI=1/C32H14/c1-2-16-6-10-20-14-22-12-8-18-4-3-17-7-11-21-13-19-9-5-15(1)23-24(16)28(20)32-30(22)26(18)25(17)29(21)31(32)27(19)23/h1-14H