19019-43-3 Usage
General Description
Glycine, N-(carboxymethyl)-N-2-(carboxymethyl)aminoethyl-, trisodium salt is a chemical compound that is commonly used as a buffering agent and chelating agent in various industries, including pharmaceuticals, cosmetics, and food production. It is a trisodium salt of an amino acid derivative, which means it contains three sodium ions. Glycine, N-(carboxymethyl)-N-2-(carboxymethyl)aminoethyl-, trisodium salt is highly soluble in water and has the ability to form stable complexes with metal ions, making it useful in applications where metal ion control is necessary. Additionally, it is known for its ability to adjust pH levels and stabilize formulations, making it a versatile and valuable chemical in many different industries.
Check Digit Verification of cas no
The CAS Registry Mumber 19019-43-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,9,0,1 and 9 respectively; the second part has 2 digits, 4 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 19019-43:
(7*1)+(6*9)+(5*0)+(4*1)+(3*9)+(2*4)+(1*3)=103
103 % 10 = 3
So 19019-43-3 is a valid CAS Registry Number.
InChI:InChI=1/C8H14N2O6.3Na/c11-6(12)3-9-1-2-10(4-7(13)14)5-8(15)16;;;/h9H,1-5H2,(H,11,12)(H,13,14)(H,15,16);;;/q;3*+1/p-3
