19077-85-1 Usage
Description
CAPENSINIDIN CHLORIDE(NEW)(SH) is an anthocyanidin cation derived from benzopyrylium with specific hydroxy substituents and methoxy groups. It is characterized by its unique chemical structure, which includes hydroxy substituents at positions 3 and 7, a methoxy group at position 5, and a 4-hydroxy-3,5-dimethoxyphenyl group at position 2. CAPENSINIDIN CHLORIDE(NEW)(SH) is known for its potential applications in various fields due to its distinct chemical properties.
Uses
Used in Pharmaceutical Industry:
CAPENSINIDIN CHLORIDE(NEW)(SH) is used as a pharmaceutical compound for its potential therapeutic applications. The compound's unique structure allows it to interact with specific biological targets, making it a candidate for the development of new drugs. Its exact application reason in the pharmaceutical industry would depend on further research and development, but it may have potential uses in treating various diseases or conditions.
Used in Cosmetic Industry:
In the cosmetic industry, CAPENSINIDIN CHLORIDE(NEW)(SH) may be used as an active ingredient for its potential antioxidant, anti-inflammatory, or skin-protective properties. The compound's chemical structure could provide benefits in skincare products, such as promoting skin health and protecting against environmental stressors.
Used in Food and Beverage Industry:
CAPENSINIDIN CHLORIDE(NEW)(SH) could be utilized in the food and beverage industry for its potential health benefits and as a natural colorant. Its anthocyanidin properties may contribute to the development of functional foods and beverages with added health-promoting qualities.
Check Digit Verification of cas no
The CAS Registry Mumber 19077-85-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,9,0,7 and 7 respectively; the second part has 2 digits, 8 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 19077-85:
(7*1)+(6*9)+(5*0)+(4*7)+(3*7)+(2*8)+(1*5)=131
131 % 10 = 1
So 19077-85-1 is a valid CAS Registry Number.
InChI:InChI=1/C18H16O7/c1-22-13-6-10(19)7-14-11(13)8-12(20)18(25-14)9-4-15(23-2)17(21)16(5-9)24-3/h4-8H,1-3H3,(H2-,19,20,21)/p+1