19198-80-2 Usage
Description
2,4-DIIODO-1H-IMIDAZOLE, also known as DII, is a chemical compound that serves as a versatile building block in organic synthesis and the production of pharmaceuticals and agrochemicals. It is recognized for its potent halogenating properties, enabling the introduction of iodine atoms into various organic structures. DII has also garnered interest for its potential as an antifungal and antibacterial agent, showing promise in inhibiting the growth of specific fungi and bacteria. However, due to its potential toxicity and irritant nature, it is crucial to handle DII with care and implement appropriate safety measures in laboratory environments.
Uses
Used in Organic Synthesis:
2,4-DIIODO-1H-IMIDAZOLE is used as a building block for the synthesis of complex organic compounds, facilitating the creation of pharmaceuticals and agrochemicals. Its ability to introduce iodine atoms into organic structures makes it a valuable component in the development of new and improved chemical entities.
Used in Pharmaceutical Production:
In the pharmaceutical industry, 2,4-DIIODO-1H-IMIDAZOLE is utilized as a key intermediate in the synthesis of various drugs. Its unique properties allow for the design of molecules with specific therapeutic effects, contributing to the advancement of medicinal chemistry.
Used in Agrochemical Development:
2,4-DIIODO-1H-IMIDAZOLE is employed as a component in the formulation of agrochemicals, particularly those intended for pest and disease control. Its role in enhancing the effectiveness of these products is crucial for ensuring agricultural productivity and crop protection.
Used as an Antifungal and Antibacterial Agent:
In the field of microbiology, 2,4-DIIODO-1H-IMIDAZOLE is used as an antifungal and antibacterial agent. It has shown potential in inhibiting the growth of certain fungi and bacteria, making it a candidate for further research and development in the area of infectious disease control.
Laboratory Research:
2,4-DIIODO-1H-IMIDAZOLE is used in laboratory research settings to explore its chemical properties and potential applications. Its reactivity and ability to form various compounds make it an interesting subject for scientific inquiry and the development of new methodologies in organic chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 19198-80-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,9,1,9 and 8 respectively; the second part has 2 digits, 8 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 19198-80:
(7*1)+(6*9)+(5*1)+(4*9)+(3*8)+(2*8)+(1*0)=142
142 % 10 = 2
So 19198-80-2 is a valid CAS Registry Number.
InChI:InChI=1/C3H2I2N2/c4-2-1-6-3(5)7-2/h1H,(H,6,7)
