19200-21-6 Usage
Description
NITRONIUM HEXAFLUOROPHOSPHATE is a chemical compound that serves as a nitrating reagent in various chemical reactions. It is known for its ability to facilitate the nitration of alkanes, which is the process of introducing a nitro group (-NO2) into the alkane molecule. NITRONIUM HEXAFLUOROPHOSPHATE is particularly useful in the synthesis of various organic compounds and plays a significant role in the field of organic chemistry.
Uses
Used in Chemical Synthesis:
NITRONIUM HEXAFLUOROPHOSPHATE is used as a nitrating reagent for the nitration of alkanes such as methane, ethane, propane, n-butane, isobutane, neopentane, and cyclohexane. The application reason is to introduce a nitro group (-NO2) into the alkane molecule, which allows for the synthesis of a wide range of organic compounds with diverse properties and applications.
In the chemical industry, the nitration of alkanes using NITRONIUM HEXAFLUOROPHOSPHATE can lead to the production of various valuable chemicals, including explosives, pharmaceuticals, and agrochemicals. The versatility of this nitrating reagent makes it an essential tool for chemists working in the development of new compounds and materials.
Check Digit Verification of cas no
The CAS Registry Mumber 19200-21-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,9,2,0 and 0 respectively; the second part has 2 digits, 2 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 19200-21:
(7*1)+(6*9)+(5*2)+(4*0)+(3*0)+(2*2)+(1*1)=76
76 % 10 = 6
So 19200-21-6 is a valid CAS Registry Number.
InChI:InChI=1/C9H6ClNOS/c10-8-3-1-7(2-4-8)9(12)5-13-6-11/h1-4H,5H2