1948-82-9 Usage
Description
1-oxopropane-1,2,3-tricarboxylic acid, also known as 2-oxoglutaric acid with an additional carboxy group at the 3-position, is a tricarboxylic acid that serves as a substrate in the citric acid cycle. It plays a crucial role in cellular respiration and energy production within living organisms.
Uses
Used in Pharmaceutical Industry:
1-oxopropane-1,2,3-tricarboxylic acid is used as an intermediate in the citric acid cycle for the production of energy in cells. Its involvement in this metabolic pathway makes it a significant compound in the pharmaceutical industry for the development of drugs targeting cellular respiration and energy metabolism.
Used in Biotechnology:
In the biotechnology field, 1-oxopropane-1,2,3-tricarboxylic acid is utilized as a substrate for the production of various biochemicals and organic compounds. Its role in the citric acid cycle allows for the generation of precursors for the synthesis of amino acids, nucleotides, and other essential biomolecules.
Used in Research and Development:
1-oxopropane-1,2,3-tricarboxylic acid is employed as a research tool in the study of cellular metabolism, the citric acid cycle, and the regulation of energy production in cells. It helps researchers understand the underlying mechanisms of these processes and develop targeted therapies for various diseases and conditions related to cellular energy metabolism.
Used in Nutritional Supplements:
As a component of the citric acid cycle, 1-oxopropane-1,2,3-tricarboxylic acid may be used in the development of nutritional supplements aimed at enhancing energy production and supporting overall health and well-being.
Used in Agricultural Industry:
In agriculture, 1-oxopropane-1,2,3-tricarboxylic acid can be used to improve plant growth and productivity by enhancing their energy production and metabolic processes. This can lead to increased crop yields and better resistance to various stress factors.
Check Digit Verification of cas no
The CAS Registry Mumber 1948-82-9 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,9,4 and 8 respectively; the second part has 2 digits, 8 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 1948-82:
(6*1)+(5*9)+(4*4)+(3*8)+(2*8)+(1*2)=109
109 % 10 = 9
So 1948-82-9 is a valid CAS Registry Number.
InChI:InChI=1/C6H6O7/c7-3(8)1-2(5(10)11)4(9)6(12)13/h2H,1H2,(H,7,8)(H,10,11)(H,12,13)