194804-85-8 Usage
Description
4-Amino-2,3-difluorobenzoic acid is a yellow solid that serves as a valuable research chemical with potential applications in various scientific and industrial fields.
Uses
Used in Research and Development:
4-Amino-2,3-difluorobenzoic acid is used as a research chemical for the development and study of new compounds and materials. Its unique chemical properties make it a promising candidate for further exploration and innovation in the field of chemistry.
Used in Pharmaceutical Industry:
4-Amino-2,3-difluorobenzoic acid is used as an intermediate in the synthesis of various pharmaceutical compounds. Its specific functional groups and structural features can be exploited to create new drugs with potential therapeutic applications.
Used in Chemical Synthesis:
In the chemical synthesis industry, 4-Amino-2,3-difluorobenzoic acid is used as a building block for the creation of more complex molecules. Its reactivity and structural characteristics can be utilized to produce a wide range of chemical products, from dyes to agrochemicals.
Used in Material Science:
4-Amino-2,3-difluorobenzoic acid can be employed in the development of new materials with specific properties, such as enhanced stability, improved thermal or mechanical characteristics, or unique optical properties. Its incorporation into polymers or other materials can lead to novel applications in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 194804-85-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,9,4,8,0 and 4 respectively; the second part has 2 digits, 8 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 194804-85:
(8*1)+(7*9)+(6*4)+(5*8)+(4*0)+(3*4)+(2*8)+(1*5)=168
168 % 10 = 8
So 194804-85-8 is a valid CAS Registry Number.
InChI:InChI=1/C7H5F2NO2/c8-5-3(7(11)12)1-2-4(10)6(5)9/h1-2H,10H2,(H,11,12)
