196194-58-8 Usage
Description
4-Chloro-2,6-difluorobenzoic acid is an organic compound characterized by its chlorine and two fluorine atoms attached to a benzoic acid structure. It is a white crystalline solid with potential applications in various industries due to its unique chemical properties.
Uses
Used in Pharmaceutical Industry:
4-Chloro-2,6-difluorobenzoic acid is used as a reactant for the preparation of substituted heterobicyclic derivatives. These derivatives are utilized as inhibitors of Bruton's tyrosine kinase (BTK), which plays a crucial role in the regulation of B-cell development and function. Inhibition of BTK has shown promise in the treatment of various B-cell malignancies and autoimmune diseases.
In the context of the pharmaceutical industry, 4-Chloro-2,6-difluorobenzoic acid serves as a key building block in the synthesis of novel BTK inhibitors, which can be further developed into potential therapeutic agents for conditions such as chronic lymphocytic leukemia (CLL), non-Hodgkin's lymphoma, and rheumatoid arthritis.
Additionally, due to its unique chemical structure, 4-Chloro-2,6-difluorobenzoic acid may also find applications in other areas of the chemical and materials science industries, such as in the development of new polymers, dyes, or other specialty chemicals.
Check Digit Verification of cas no
The CAS Registry Mumber 196194-58-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,9,6,1,9 and 4 respectively; the second part has 2 digits, 5 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 196194-58:
(8*1)+(7*9)+(6*6)+(5*1)+(4*9)+(3*4)+(2*5)+(1*8)=178
178 % 10 = 8
So 196194-58-8 is a valid CAS Registry Number.
InChI:InChI=1/C7H3ClF2O2/c8-3-1-4(9)6(7(11)12)5(10)2-3/h1-2H,(H,11,12)
196194-58-8Relevant articles and documents
FUSED BICYCLIC COMPOUND
-
Page/Page column 49-50, (2010/05/13)
The present invention provides a novel fused bicyclic compound having an affinity to a receptor of mineral corticoid (MR), shown by the formula [I]: wherein the ring A is a benzene ring having a substituent R1, fused to an adjacent 6-membered h
