199006-54-7 Usage
Description
FMOC-L-4-Methylphe, also known as N-Fmoc-4-methyl-L-phenylalanine, is a chemical compound that serves as a pharmaceutical intermediate. It is characterized by its white powder form and is utilized in the synthesis of various pharmaceuticals due to its unique chemical properties.
Uses
Used in Pharmaceutical Industry:
FMOC-L-4-Methylphe is used as a pharmaceutical intermediate for the synthesis of various drugs and medications. Its application is primarily due to its unique chemical structure, which allows for the creation of complex molecules with specific therapeutic properties.
As a pharmaceutical intermediate, FMOC-L-4-Methylphe plays a crucial role in the development of new drugs and the improvement of existing ones. Its versatility in chemical reactions enables the production of a wide range of pharmaceutical compounds with diverse applications in the medical field.
Check Digit Verification of cas no
The CAS Registry Mumber 199006-54-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,9,9,0,0 and 6 respectively; the second part has 2 digits, 5 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 199006-54:
(8*1)+(7*9)+(6*9)+(5*0)+(4*0)+(3*6)+(2*5)+(1*4)=157
157 % 10 = 7
So 199006-54-7 is a valid CAS Registry Number.
InChI:InChI=1/C25H23NO4/c1-16-10-12-17(13-11-16)14-23(24(27)28)26-25(29)30-15-22-20-8-4-2-6-18(20)19-7-3-5-9-21(19)22/h2-13,22-23H,14-15H2,1H3,(H,26,29)(H,27,28)/t23-/m0/s1
199006-54-7Relevant articles and documents
Ligand-Enabled β-C–H Arylation of α-Amino Acids Without Installing Exogenous Directing Groups
Chen, Gang,Zhuang, Zhe,Li, Gen-Cheng,Saint-Denis, Tyler G.,Hsiao, Yi,Joe, Candice L.,Yu, Jin-Quan
, p. 1506 - 1509 (2017)
Herein we report acid-directed β-C(sp3)-H arylation of α-amino acids enabled by pyridine-type ligands. This reaction does not require the installation of an exogenous directing group, is scalable, and enables the preparation of Fmoc-protected unnatural amino acids in three steps. The pyridine-type ligands are crucial for the development of this new C(sp3)-H arylation.