201849-16-3 Usage
Description
1-Bromo-5-chloro-3-fluoro-2-iodobenzene is a halogenated aromatic compound that features a benzene ring with a bromine atom at the 1st position, a chlorine atom at the 5th position, a fluorine atom at the 3rd position, and an iodine atom at the 2nd position. This unique arrangement of halogens on the benzene ring provides distinct chemical and physical properties, making it a versatile building block in organic synthesis.
Uses
Used in Organic Synthesis:
1-Bromo-5-chloro-3-fluoro-2-iodobenzene is used as a key intermediate in the synthesis of various organic compounds, particularly those used in the development of organic electronic devices. Its diverse functional groups allow for a wide range of chemical reactions, facilitating the creation of complex molecules with specific electronic properties.
Used in Organic Electronic Devices:
1-Bromo-5-chloro-3-fluoro-2-iodobenzene is used as a precursor for the production of organic electronic devices, such as organic light-emitting diodes (OLEDs), organic photovoltaics (OPVs), and organic field-effect transistors (OFETs). The presence of multiple halogens on the benzene ring can influence the electronic properties of the resulting compounds, making them suitable for use in these advanced technologies.
Used in Pharmaceutical Industry:
1-Bromo-5-chloro-3-fluoro-2-iodobenzene can also be used as a building block in the development of pharmaceutical compounds. Its unique structure and reactivity can be exploited to create new drugs with specific therapeutic properties, potentially leading to the discovery of novel treatments for various diseases.
Used in Chemical Research:
In addition to its practical applications, 1-Bromo-5-chloro-3-fluoro-2-iodobenzene serves as an important compound in chemical research. Its synthesis and reactions can provide valuable insights into the behavior of halogenated aromatics, contributing to the broader understanding of organic chemistry and its applications.
Check Digit Verification of cas no
The CAS Registry Mumber 201849-16-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,0,1,8,4 and 9 respectively; the second part has 2 digits, 1 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 201849-16:
(8*2)+(7*0)+(6*1)+(5*8)+(4*4)+(3*9)+(2*1)+(1*6)=113
113 % 10 = 3
So 201849-16-3 is a valid CAS Registry Number.
InChI:InChI=1/C6H2BrClFI/c7-4-1-3(8)2-5(9)6(4)10/h1-2H
201849-16-3Relevant articles and documents
Compound, hole transport material, organic electroluminescent device and display device
-
Paragraph 0103-0105; 0112-0114; 0126-0128, (2020/10/14)
The embodiment of the invention provides a compound shown as a general formula (I), which can be used for an organic light-emitting device and used as a hole transport material. The compound has an asymmetric disubstituted dibenzoheterocycle parent structure, which has high bond energy between atoms and good thermal stability, so that the service life of the material is prolonged. When being usedas a hole transport layer material, the organic electroluminescent material has a proper energy level with an adjacent layer, is beneficial to hole injection and migration, can effectively reduce driving voltage, has a high hole migration rate, and can effectively improve the luminous efficiency of a device.