20219-33-4 Usage
Description
Tantalum(V) Tetraethoxide 2,4-Pentanedionate is a chemical compound derived from tantalum, a transition metal with multiple oxidation states. It is characterized by its unique chemical structure and properties, making it a versatile compound with various applications across different industries.
Uses
Used in Pharmaceutical Industry:
Tantalum(V) Tetraethoxide 2,4-Pentanedionate is used as a catalyst and reagent for the synthesis of various pharmaceutical compounds. Its unique chemical properties enable it to facilitate specific reactions, leading to the production of desired pharmaceutical products with improved efficiency and selectivity.
Used in Biochemical Industry:
In the biochemical industry, Tantalum(V) Tetraethoxide 2,4-Pentanedionate is utilized as a catalyst in the synthesis of complex organic molecules and biologically active compounds. Its ability to promote specific reactions and enhance the formation of target molecules makes it a valuable tool in the development of new biochemical products.
Used in Chemical Industry:
Tantalum(V) Tetraethoxide 2,4-Pentanedionate is employed as a catalyst in various chemical reactions, particularly in the synthesis of organic compounds and materials. Its unique properties allow it to improve the efficiency and selectivity of these reactions, leading to the production of high-quality chemical products with a wide range of applications.
Check Digit Verification of cas no
The CAS Registry Mumber 20219-33-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,0,2,1 and 9 respectively; the second part has 2 digits, 3 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 20219-33:
(7*2)+(6*0)+(5*2)+(4*1)+(3*9)+(2*3)+(1*3)=64
64 % 10 = 4
So 20219-33-4 is a valid CAS Registry Number.
InChI:InChI=1/C5H8O2.4C2H5O.Ta/c1-4(6)3-5(2)7;4*1-2-3;/h3,6H,1-2H3;4*2H2,1H3;/q;4*-1;+5/p-1/b4-3-;;;;;/rC13H27O6Ta/c1-7-14-20(15-8-2,16-9-3,17-10-4)18-12(5)11-13(6)19-20/h11H,7-10H2,1-6H3
