203506-01-8 Usage
Description
2-Amino-6-bromo-3-methylquinoline is an organic heterocyclic compound with the molecular formula C10H8BrN. It features a quinoline ring structure with a bromine atom and a methyl group attached, resulting in a yellow crystalline solid. This chemical is known for its potential applications in pharmaceuticals and agrochemicals, as well as its studied anticancer and antimicrobial properties. Due to its limited solubility in water and greater solubility in organic solvents, careful handling and storage are necessary to mitigate potential health and environmental risks.
Uses
Used in Pharmaceutical Industry:
2-Amino-6-bromo-3-methylquinoline serves as a crucial building block in the synthesis of various pharmaceuticals. Its unique structure allows it to be a key component in the development of new drugs, particularly those targeting specific biological pathways or diseases.
Used in Agrochemical Industry:
In the agrochemical sector, 2-Amino-6-bromo-3-methylquinoline is utilized as a starting material for the creation of compounds with pesticidal properties. Its ability to be modified and incorporated into larger molecules makes it a valuable asset in designing effective and targeted agrochemicals.
Used in Anticancer Research:
2-Amino-6-bromo-3-methylquinoline has been studied for its potential as an anticancer agent. Its specific molecular structure may contribute to its ability to interact with cellular processes, making it a candidate for further research and development in oncology.
Used in Antimicrobial Applications:
2-AMINO-6-BROMO-3-METHYLQUINOLINE's antimicrobial properties are of interest for applications in which control of microbial growth is necessary. This can include uses in medical settings, as well as in the development of antimicrobial coatings or materials for various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 203506-01-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,0,3,5,0 and 6 respectively; the second part has 2 digits, 0 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 203506-01:
(8*2)+(7*0)+(6*3)+(5*5)+(4*0)+(3*6)+(2*0)+(1*1)=78
78 % 10 = 8
So 203506-01-8 is a valid CAS Registry Number.
InChI:InChI=1/C10H9BrN2/c1-6-4-7-5-8(11)2-3-9(7)13-10(6)12/h2-5H,1H3,(H2,12,13)