20503-88-2 Usage
Description
1-(4,5-diphenyl-1,3-oxazol-2-yl)-4-methyl-piperazine is a complex chemical compound featuring a piperazine ring with a 4-methyl group and a 1,3-oxazole ring with phenyl substitutions at the 4 and 5 positions. 1-(4,5-diphenyl-1,3-oxazol-2-yl)-4-methyl-piperazine holds potential pharmacological properties and is being explored for its use in drug development, particularly in medicinal chemistry for creating pharmaceuticals that target specific biological pathways. Its unique structure positions it as a promising candidate for further research and development within the pharmaceutical industry.
Uses
Used in Pharmaceutical Development:
1-(4,5-diphenyl-1,3-oxazol-2-yl)-4-methyl-piperazine is used as a compound in pharmaceutical development for its potential to target specific biological pathways. Its unique structure allows for the creation of new drugs that can interact with these pathways, potentially leading to novel treatments for various medical conditions.
Used in Medicinal Chemistry:
In the field of medicinal chemistry, 1-(4,5-diphenyl-1,3-oxazol-2-yl)-4-methyl-piperazine is used as a building block for designing new pharmaceuticals. Its complex structure and potential pharmacological properties make it a valuable tool for researchers aiming to develop innovative drugs with specific therapeutic applications.
Used in Drug Delivery Systems:
1-(4,5-diphenyl-1,3-oxazol-2-yl)-4-methyl-piperazine may also be utilized in the development of drug delivery systems, where its unique structure could enhance the delivery, bioavailability, and therapeutic outcomes of certain pharmaceuticals. This application could be particularly beneficial in improving the efficacy of drugs that face limitations in their current forms.
Used in Research and Development:
As a promising candidate for further research and development, 1-(4,5-diphenyl-1,3-oxazol-2-yl)-4-methyl-piperazine is used in the pharmaceutical industry to explore new avenues for drug discovery and innovation. Its potential applications in various therapeutic areas make it a valuable asset for scientists and researchers working to advance the field of medicine.
Check Digit Verification of cas no
The CAS Registry Mumber 20503-88-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,0,5,0 and 3 respectively; the second part has 2 digits, 8 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 20503-88:
(7*2)+(6*0)+(5*5)+(4*0)+(3*3)+(2*8)+(1*8)=72
72 % 10 = 2
So 20503-88-2 is a valid CAS Registry Number.
InChI:InChI=1/C20H21N3O/c1-22-12-14-23(15-13-22)20-21-18(16-8-4-2-5-9-16)19(24-20)17-10-6-3-7-11-17/h2-11H,12-15H2,1H3