205526-24-5 Usage
Description
FMOC-L-3,5-DIFLUOROPHE, also known as 3,5-Difluoro-N-Fmoc-L-phenylalanine, is a chemical compound that is a derivative of L-phenylalanine. It is characterized by its white to off-white crystalline powder appearance. FMOC-L-3,5-DIFLUOROPHE is primarily used in the synthesis of high-quality peptides, making it a valuable component in the field of pharmaceuticals and biochemistry.
Uses
Used in Pharmaceutical Industry:
FMOC-L-3,5-DIFLUOROPHE is used as a building block for the synthesis of high-quality peptides. Its application is crucial in the development of new drugs and therapeutic agents, as it allows for the creation of peptides with specific properties and functions. The compound's unique structure enables the production of peptides that can be tailored to target specific biological pathways or receptors, potentially leading to more effective treatments for various diseases and conditions.
Used in Biochemical Research:
In addition to its pharmaceutical applications, FMOC-L-3,5-DIFLUOROPHE is also utilized in biochemical research. It serves as a valuable tool for studying the structure and function of peptides, as well as their interactions with other biomolecules. FMOC-L-3,5-DIFLUOROPHE can be used to investigate the mechanisms of peptide-protein interactions, enzyme catalysis, and other biological processes, contributing to a deeper understanding of the molecular basis of life.
Check Digit Verification of cas no
The CAS Registry Mumber 205526-24-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,0,5,5,2 and 6 respectively; the second part has 2 digits, 2 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 205526-24:
(8*2)+(7*0)+(6*5)+(5*5)+(4*2)+(3*6)+(2*2)+(1*4)=105
105 % 10 = 5
So 205526-24-5 is a valid CAS Registry Number.
InChI:InChI=1/C24H19F2NO4/c25-15-9-14(10-16(26)12-15)11-22(23(28)29)27-24(30)31-13-21-19-7-3-1-5-17(19)18-6-2-4-8-20(18)21/h1-10,12,21-22H,11,13H2,(H,27,30)(H,28,29)/t22-/m1/s1