205526-65-4 Usage
Description
N-PHENYL-1-NAPHTHYLAMINE HYDROBROMIDE, 98 is a light purple crystalline powder that is commonly used as an impurity in the production of Albuterol sulfate (Salbutamol sulfate) bulk drug. It is a chemical compound with a specific molecular structure that contributes to its unique properties and applications.
Uses
Used in Pharmaceutical Industry:
N-PHENYL-1-NAPHTHYLAMINE HYDROBROMIDE, 98 is used as an impurity in the production of Albuterol sulfate (Salbutamol sulfate) bulk drug for the following reasons:
1. It serves as a reference compound for the identification and quantification of impurities in the manufacturing process of Albuterol sulfate.
2. The presence of this impurity helps in ensuring the quality control and purity of the final drug product, as it can be monitored and controlled during the synthesis process.
Used in Chemical Research:
N-PHENYL-1-NAPHTHYLAMINE HYDROBROMIDE, 98 is used as a research compound in various chemical and pharmaceutical studies for the following reasons:
1. Its unique chemical properties and structure make it a valuable compound for understanding the behavior of similar compounds in various chemical reactions and processes.
2. It can be used as a starting material or intermediate in the synthesis of other related compounds with potential applications in the pharmaceutical, chemical, or materials science industries.
Used in Quality Control and Analysis:
N-PHENYL-1-NAPHTHYLAMINE HYDROBROMIDE, 98 is used as a reference standard in quality control and analytical testing for the following reasons:
1. It provides a known reference for the identification and quantification of impurities in Albuterol sulfate and other related drugs, ensuring the accuracy and reliability of analytical results.
2. Its use in quality control processes helps maintain the safety and efficacy of pharmaceutical products by ensuring that impurity levels are within acceptable limits.
Check Digit Verification of cas no
The CAS Registry Mumber 205526-65-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,0,5,5,2 and 6 respectively; the second part has 2 digits, 6 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 205526-65:
(8*2)+(7*0)+(6*5)+(5*5)+(4*2)+(3*6)+(2*6)+(1*5)=114
114 % 10 = 4
So 205526-65-4 is a valid CAS Registry Number.
InChI:InChI=1/C16H13N.BrH/c1-2-9-14(10-3-1)17-16-12-6-8-13-7-4-5-11-15(13)16;/h1-12,17H;1H
