20621-25-4 Usage
Description
DIMETHYL N,N-DIETHYLPHOSPHORAMIDITE, also known as a phosphitylating agent, is a colorless liquid with significant importance in the field of organic chemistry. It is widely recognized for its ability to efficiently catalyze the phosphorylation of alcohols, making it a valuable compound for various applications.
Uses
Used in Organic Chemistry:
DIMETHYL N,N-DIETHYLPHOSPHORAMIDITE is used as a reagent for the efficient phosphorylation of alcohols. Its application is crucial in the synthesis of various biologically active molecules, including nucleotides, phospholipids, and other phosphorylated compounds, due to its ability to facilitate the formation of phosphodiester bonds.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, DIMETHYL N,N-DIETHYLPHOSPHORAMIDITE is used as a key intermediate in the synthesis of various drugs, particularly those involving the incorporation of phosphoryl groups. Its role in drug development is essential for creating novel therapeutic agents with potential applications in treating a wide range of diseases.
Used in Chemical Research:
DIMETHYL N,N-DIETHYLPHOSPHORAMIDITE is also utilized in chemical research as a versatile tool for studying the properties and reactivity of phosphorylated compounds. Its use in research allows scientists to gain a deeper understanding of the mechanisms involved in phosphorylation reactions and to develop new strategies for the synthesis of complex molecules.
Overall, DIMETHYL N,N-DIETHYLPHOSPHORAMIDITE is a versatile and essential compound in the fields of organic chemistry, pharmaceuticals, and chemical research, playing a crucial role in the synthesis and development of various biologically active molecules and therapeutic agents.
Check Digit Verification of cas no
The CAS Registry Mumber 20621-25-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,0,6,2 and 1 respectively; the second part has 2 digits, 2 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 20621-25:
(7*2)+(6*0)+(5*6)+(4*2)+(3*1)+(2*2)+(1*5)=64
64 % 10 = 4
So 20621-25-4 is a valid CAS Registry Number.
InChI:InChI=1/C6H16NO2P/c1-5-7(6-2)10(8-3)9-4/h5-6H2,1-4H3
