206555-32-0 Usage
Description
4-(3-Chloro-phenyl)-5-methyl-thiazol-2-ylamine is a chemical compound belonging to the thiazole class, featuring a thiazole ring with an amine group, a methyl group, and a 3-chloro-phenyl group. 4-(3-Chloro-phenyl)-5methyl-thiazol-2-ylamine is widely utilized in pharmaceutical research and drug development due to its unique structure and properties, which may contribute to the treatment of various diseases and conditions. Its potential applications in medicinal chemistry and organic synthesis make it a subject of interest for researchers working on the development of new drugs and therapies.
Uses
Used in Pharmaceutical Research and Drug Development:
4-(3-Chloro-phenyl)-5-methyl-thiazol-2-ylamine is used as a key intermediate in the synthesis of various pharmaceutical compounds for the treatment of different diseases and conditions. Its unique structure and properties allow it to interact with biological targets, making it a promising candidate for drug discovery and development.
Used in Medicinal Chemistry:
In the field of medicinal chemistry, 4-(3-Chloro-phenyl)-5-methyl-thiazol-2-ylamine is used as a building block for the design and synthesis of novel therapeutic agents. Its presence in the compound can modulate the pharmacological properties, such as potency, selectivity, and bioavailability, leading to the development of more effective drugs.
Used in Organic Synthesis:
4-(3-Chloro-phenyl)-5-methyl-thiazol-2-ylamine is also used as a versatile synthetic building block in organic synthesis. Its reactivity and functional groups enable the formation of various chemical entities, which can be further utilized in the synthesis of complex organic molecules with potential applications in various industries, including pharmaceuticals, agrochemicals, and materials science.
Used in Drug Discovery:
4-(3-Chloro-phenyl)-5-methyl-thiazol-2-ylamine is employed as a starting material or a scaffold in the drug discovery process. Its unique structural features and chemical properties make it an attractive candidate for the development of new drugs with improved therapeutic profiles, such as enhanced efficacy, selectivity, and safety.
Check Digit Verification of cas no
The CAS Registry Mumber 206555-32-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,0,6,5,5 and 5 respectively; the second part has 2 digits, 3 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 206555-32:
(8*2)+(7*0)+(6*6)+(5*5)+(4*5)+(3*5)+(2*3)+(1*2)=120
120 % 10 = 0
So 206555-32-0 is a valid CAS Registry Number.
InChI:InChI=1/C10H9ClN2S/c1-6-9(13-10(12)14-6)7-3-2-4-8(11)5-7/h2-5H,1H3,(H2,12,13)