206559-37-7 Usage
General Description
4-(4-Benzyloxyphenyl)-3-thiosemicarbazide is a chemical compound with the molecular formula C15H16N4OS. It is a thiosemicarbazide derivative that contains a benzyl ether group and a phenyl group. 4-(4-BENZYLOXYPHENYL)-3-THIOSEMICARBAZIDE has potential applications in medicinal chemistry and as a building block for the synthesis of bioactive molecules. Thiosemicarbazides are known for their diverse biological activities, such as antimicrobial, antitumor, and antiviral properties. The specific properties and uses of 4-(4-Benzyloxyphenyl)-3-thiosemicarbazide depend on its chemical structure and can be further explored through research and experimentation.
Check Digit Verification of cas no
The CAS Registry Mumber 206559-37-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,0,6,5,5 and 9 respectively; the second part has 2 digits, 3 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 206559-37:
(8*2)+(7*0)+(6*6)+(5*5)+(4*5)+(3*9)+(2*3)+(1*7)=137
137 % 10 = 7
So 206559-37-7 is a valid CAS Registry Number.
InChI:InChI=1/C14H15N3OS/c15-17-14(19)16-12-6-8-13(9-7-12)18-10-11-4-2-1-3-5-11/h1-9H,10,15H2,(H2,16,17,19)
