206761-85-5 Usage
General Description
4-(4-phenoxypenyl)-3-thiosemicarbazide is a chemical compound with the molecular formula C13H12N4OS. It is a thiosemicarbazide derivative with a phenoxypenyl group attached to its structure. 4-(4-PHENOXYPHENYL)-3-THIOSEMICARBAZIDE has potential applications in organic synthesis and medicinal chemistry, as thiosemicarbazides are known for their antimicrobial, anticancer, and antiviral properties. Additionally, the phenoxypenyl group may contribute to its potential biological activities. Further research and evaluation of its pharmacological properties may lead to the development of new therapeutic agents.
Check Digit Verification of cas no
The CAS Registry Mumber 206761-85-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,0,6,7,6 and 1 respectively; the second part has 2 digits, 8 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 206761-85:
(8*2)+(7*0)+(6*6)+(5*7)+(4*6)+(3*1)+(2*8)+(1*5)=135
135 % 10 = 5
So 206761-85-5 is a valid CAS Registry Number.
InChI:InChI=1/C13H13N3OS/c14-16-13(18)15-10-6-8-12(9-7-10)17-11-4-2-1-3-5-11/h1-9H,14H2,(H2,15,16,18)