207121-46-8 Usage
Description
D-Cysteine Hydrochloride is an amino acid derivative that plays a crucial role in various biological processes. It is characterized by the presence of a thiol group, which allows it to act as a reducing agent and participate in redox reactions. D-Cysteine Hydrochloride is essential for the proper functioning of cells and is involved in the synthesis of proteins, antioxidants, and other biologically active molecules.
Uses
Used in Biomedical Research:
D-Cysteine Hydrochloride is used as a reactant in the synthesis of electronically modified luciferins for bioluminescence imaging. This application is particularly valuable in the field of biomedical research, as it allows for the visualization and tracking of biological processes in living organisms. The use of D-Cysteine Hydrochloride in this context enables researchers to gain insights into cellular mechanisms, disease progression, and the effectiveness of therapeutic interventions.
Check Digit Verification of cas no
The CAS Registry Mumber 207121-46-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,0,7,1,2 and 1 respectively; the second part has 2 digits, 4 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 207121-46:
(8*2)+(7*0)+(6*7)+(5*1)+(4*2)+(3*1)+(2*4)+(1*6)=88
88 % 10 = 8
So 207121-46-8 is a valid CAS Registry Number.
InChI:InChI=1/C3H7NO2S.ClH.H2O/c4-2(1-7)3(5)6;;/h2,7H,1,4H2,(H,5,6);1H;1H2/t2-;;/m1../s1
