207683-26-9 Usage
Description
Dipyrrolidino(N-succinimidyloxy)carbenium hexafluorophosphate is a white solid that serves as a versatile reactant in the synthesis of various compounds, including caspase-sensitive gold nanoparticles.
Uses
Used in Synthesis of Nanoparticles:
Dipyrrolidino(N-succinimidyloxy)carbenium hexafluorophosphate is used as a reactant for the synthesis of caspase-sensitive gold nanoparticles. This application is significant because it allows for the development of nanoparticles with specific targeting and sensing capabilities, which can be utilized in various fields such as medicine, diagnostics, and drug delivery.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, Dipyrrolidino(N-succinimidyloxy)carbenium hexafluorophosphate is used as a key intermediate in the synthesis of various drug molecules. Its unique chemical properties enable the creation of novel compounds with potential therapeutic applications.
Used in Chemical Research:
Dipyrrolidino(N-succinimidyloxy)carbenium hexafluorophosphate is also used as a research tool in chemical laboratories. Its reactivity and stability make it a valuable compound for studying various chemical reactions and mechanisms, contributing to the advancement of chemical knowledge and the development of new materials and applications.
Check Digit Verification of cas no
The CAS Registry Mumber 207683-26-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,0,7,6,8 and 3 respectively; the second part has 2 digits, 2 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 207683-26:
(8*2)+(7*0)+(6*7)+(5*6)+(4*8)+(3*3)+(2*2)+(1*6)=139
139 % 10 = 9
So 207683-26-9 is a valid CAS Registry Number.
InChI:InChI=1/C13H20N3O3/c17-11-5-6-12(18)16(11)19-13(14-7-1-2-8-14)15-9-3-4-10-15/h1-10H2/q+1
