2105-44-4 Usage
General Description
S-[2-[[(4-amino-2-methylpyrimidin-5-yl)methyl]formylamino]-1-[2-(benzoyloxy)ethyl]prop-1-en-1-yl]benzenecarbothioate monohydrochloride is a complex chemical compound with a long and detailed name. It is a monohydrochloride salt, which means it contains a positively charged organic molecule and a negatively charged chloride ion. The compound contains a mixture of functional groups, including amino, formylamino, propenyl, and benzoyloxy groups, as well as a benzenecarbothioate moiety. The compound is likely used in pharmaceutical or chemical research due to its complex structure and potentially unique biological or chemical properties.
Check Digit Verification of cas no
The CAS Registry Mumber 2105-44-4 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 2,1,0 and 5 respectively; the second part has 2 digits, 4 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 2105-44:
(6*2)+(5*1)+(4*0)+(3*5)+(2*4)+(1*4)=44
44 % 10 = 4
So 2105-44-4 is a valid CAS Registry Number.
InChI:InChI=1/C26H26N4O4S.ClH/c1-17(29-23(31)15-21-16-28-18(2)30-24(21)27)22(35-26(33)20-11-7-4-8-12-20)13-14-34-25(32)19-9-5-3-6-10-19;/h3-12,16H,13-15H2,1-2H3,(H,29,31)(H2,27,28,30);1H