2109-45-7 Usage
Description
2-[[(2-amino-5-chlorophenyl)phenylmethylene]amino]ethanol, also known as 2-Amino-5-chloro-α-phenylbenzylideneaminoethanol, is an organic compound that serves as a crucial intermediate in the synthesis of various pharmaceutical compounds. It is characterized by its unique molecular structure, which includes an amino group, a chlorophenyl group, and a phenylmethylene group attached to an ethanol molecule. 2-[[(2-amino-5-chlorophenyl)phenylmethylene]amino]ethanol plays a significant role in the development of new drugs and therapeutic agents.
Uses
Used in Pharmaceutical Industry:
2-[[(2-amino-5-chlorophenyl)phenylmethylene]amino]ethanol is used as an intermediate in the synthesis of Clorazepic Acid (C587365) related compounds. It is essential for the development of new drugs and therapeutic agents, particularly in the field of pharmaceuticals. Its unique molecular structure allows for the creation of various derivatives with potential applications in treating different medical conditions.
As an intermediate, 2-[[(2-amino-5-chlorophenyl)phenylmethylene]amino]ethanol contributes to the synthesis of Clorazepic Acid and its related compounds, which may have potential applications in various therapeutic areas. The compound's versatility in chemical reactions enables the development of a wide range of pharmaceutical products with diverse therapeutic properties.
Check Digit Verification of cas no
The CAS Registry Mumber 2109-45-7 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 2,1,0 and 9 respectively; the second part has 2 digits, 4 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 2109-45:
(6*2)+(5*1)+(4*0)+(3*9)+(2*4)+(1*5)=57
57 % 10 = 7
So 2109-45-7 is a valid CAS Registry Number.
InChI:InChI=1/C15H15ClN2O/c16-12-6-7-14(17)13(10-12)15(18-8-9-19)11-4-2-1-3-5-11/h1-7,10,19H,8-9,17H2/b18-15+
