210963-94-3 Usage
General Description
Methyl 6-(1-pyrrolidinyl)nicotinate is a chemical compound with the molecular formula C13H17NO2. It is a derivative of niacin, also known as vitamin B3, and contains a pyrrolidinyl group attached to the niacin structure. METHYL 6-(1-PYRROLIDINYL)NICOTINATE has been researched for its potential pharmacological properties, particularly its potential as a ligand for nicotinic acetylcholine receptors in the central nervous system. It may also have potential as a therapeutic agent for various neurological disorders. Additionally, methyl 6-(1-pyrrolidinyl)nicotinate may have applications in the field of drug discovery and development. Further research and studies are needed to fully understand the potential uses and effects of this compound.
Check Digit Verification of cas no
The CAS Registry Mumber 210963-94-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,1,0,9,6 and 3 respectively; the second part has 2 digits, 9 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 210963-94:
(8*2)+(7*1)+(6*0)+(5*9)+(4*6)+(3*3)+(2*9)+(1*4)=123
123 % 10 = 3
So 210963-94-3 is a valid CAS Registry Number.
InChI:InChI=1/C12H16N2O2/c1-2-16-12(15)10-5-6-11(13-9-10)14-7-3-4-8-14/h5-6,9H,2-4,7-8H2,1H3
