21106-04-7 Usage
Description
O-Cbz-L-Tyrosine, also known as O-Benzyloxycarbonyl-L-tyrosine, is a chemical compound derived from L-tyrosine, an essential amino acid. It is characterized by the presence of a benzyloxycarbonyl (Cbz) protecting group attached to the hydroxyl group of the tyrosine molecule. This modification enhances the stability and solubility of the compound, making it suitable for various applications in the pharmaceutical and chemical industries.
Uses
Used in Pharmaceutical Industry:
O-Cbz-L-Tyrosine is used as an intermediate in the synthesis of various pharmaceutical compounds, particularly those involving the incorporation of tyrosine residues. The benzyloxycarbonyl group serves as a temporary protecting group during the synthesis process, which can be selectively removed under mild conditions to yield the desired product.
Used in Peptide Synthesis:
O-Cbz-L-Tyrosine is used as a building block in the solid-phase peptide synthesis (SPPS) of peptide-based drugs and therapeutic agents. The Cbz group provides protection to the tyrosine side chain during the synthesis, preventing unwanted side reactions and ensuring the correct formation of peptide bonds.
Used in Animal Models:
O-Cbz-L-Tyrosine is used to improve its biological efficiency in animal models of multiple sclerosis. O-Cbz-L-Tyrosine may exhibit neuroprotective or immunomodulatory effects, potentially leading to the development of new treatments for this debilitating neurological disorder.
Check Digit Verification of cas no
The CAS Registry Mumber 21106-04-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,1,1,0 and 6 respectively; the second part has 2 digits, 0 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 21106-04:
(7*2)+(6*1)+(5*1)+(4*0)+(3*6)+(2*0)+(1*4)=47
47 % 10 = 7
So 21106-04-7 is a valid CAS Registry Number.
InChI:InChI=1/C17H17NO5/c18-15(16(19)20)10-12-6-8-14(9-7-12)23-17(21)22-11-13-4-2-1-3-5-13/h1-9,15H,10-11,18H2,(H,19,20)
