21109-27-3 Usage
General Description
(5-Chloro-1H-indol-2-yl)methanamine is a chemical compound that falls under the category of indoles - a class of chemicals largely found in nature and are essential to numerous biological processes. This particular compound has a chloro and an amino group attached to, indicating its potential use in chemical synthesis, specifically in organic chemistry. The compound's specific properties, including its melting point, boiling point, molecular weight, density, and potential hazards or toxicity, may vary and usually depend on its specific state, concentration, and conditions under which it is stored or used. The potential real-world applications of (5-Chloro-1H-indol-2-yl)methanamine would largely depend on its interactions and reactions with other substances.
Check Digit Verification of cas no
The CAS Registry Mumber 21109-27-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,1,1,0 and 9 respectively; the second part has 2 digits, 2 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 21109-27:
(7*2)+(6*1)+(5*1)+(4*0)+(3*9)+(2*2)+(1*7)=63
63 % 10 = 3
So 21109-27-3 is a valid CAS Registry Number.
InChI:InChI=1/C9H9ClN2/c10-7-1-2-9-6(3-7)4-8(5-11)12-9/h1-4,12H,5,11H2
